For research use only. Not for therapeutic Use.
BSJ-03-123（Cat No.:I019499） is a compound that belongs to the phthalimide-based class of molecules and functions as a cyclin-dependent kinase 6 (CDK6) degrader. CDK6 is a protein involved in cell cycle regulation and is a potential target for cancer therapy. BSJ-03-123 is designed to specifically degrade CDK6, leading to its targeted elimination within cells. By inhibiting CDK6, BSJ-03-123 may disrupt cell cycle progression and potentially exert anti-proliferative effects in cancer cells.
| Catalog Number | I019499 |
| CAS Number | 2361493-16-3 |
| Molecular Formula | C₄₇H₅₆N₁₀O₁₁ |
| Purity | ≥95% |
| Storage | 4°C, protect from light |
| IUPAC Name | N-[2-[2-[2-[2-[4-[6-[(6-acetyl-8-cyclopentyl-5-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]pyridin-3-yl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
| InChI | InChI=1S/C47H56N10O11/c1-29-34-27-50-47(53-42(34)56(31-6-3-4-7-31)45(63)40(29)30(2)58)51-37-12-10-32(26-49-37)55-17-15-54(16-18-55)19-21-66-23-25-67-24-22-65-20-14-48-39(60)28-68-36-9-5-8-33-41(36)46(64)57(44(33)62)35-11-13-38(59)52-43(35)61/h5,8-10,12,26-27,31,35H,3-4,6-7,11,13-25,28H2,1-2H3,(H,48,60)(H,52,59,61)(H,49,50,51,53) |
| InChIKey | LUHCYAOYQIFNRN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCN(CC4)CCOCCOCCOCCNC(=O)COC5=CC=CC6=C5C(=O)N(C6=O)C7CCC(=O)NC7=O)C8CCCC8)C(=O)C |
| Reference | [1]. Brand M, et al. Homolog-Selective Degradation as a Strategy to Probe the Function of CDK6 in AML. Cell Chem Biol. 2019 Feb 21;26(2):300-306.e9. |
