For research use only. Not for therapeutic Use.
BSJ-04-122（Cat No.:I042278）is an experimental compound under investigation for its potential therapeutic applications, particularly in the treatment of various cancers. It functions as a selective inhibitor targeting specific molecular pathways involved in cancer cell proliferation, survival, and metastasis. By disrupting these pathways, BSJ-04-122 aims to suppress tumor growth and enhance the effectiveness of other cancer treatments. Preclinical studies have shown promising results, indicating its potential to inhibit the spread of cancer cells. BSJ-04-122 is a subject of ongoing research, and further studies are needed to assess its clinical efficacy and safety.
| CAS Number | 2513289-74-0 |
| Synonyms | N-[2-[(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]phenyl]prop-2-enamide |
| Molecular Formula | C15H12ClN5O |
| Purity | ≥95% |
| IUPAC Name | N-[2-[(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]phenyl]prop-2-enamide |
| InChI | InChI=1S/C15H12ClN5O/c1-2-12(22)20-10-5-3-4-6-11(10)21-15-13-9(16)7-17-14(13)18-8-19-15/h2-8H,1H2,(H,20,22)(H2,17,18,19,21) |
| InChIKey | LWXOPXNDPRPGMJ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=CC=CC=C1NC2=NC=NC3=C2C(=CN3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
