For research use only. Not for therapeutic Use.
BTD (Cat No.:I023764) is an experimental compound being studied for its potential applications in organic synthesis and materials science. It contains a bromotrifluoromethyl group, which enhances its reactivity and ability to participate in specific chemical reactions. BTD is being explored as a building block in the development of novel compounds with applications in drug discovery, molecular electronics, and polymers. Its unique structure and reactivity make it a valuable candidate for the design of targeted therapies and advanced materials. Research is ongoing to explore its broader chemical and biological properties.
CAS Number | 896684-04-1 |
Synonyms | N-[3-(1-adamantyloxy)propyl]-3-(6-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)propanamide |
Molecular Formula | C24H33N3O4S |
Purity | ≥95% |
IUPAC Name | N-[3-(1-adamantyloxy)propyl]-3-(6-methyl-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)propanamide |
InChI | InChI=1S/C24H33N3O4S/c1-16-3-4-21-20(9-16)26-22(27-32(21,29)30)5-6-23(28)25-7-2-8-31-24-13-17-10-18(14-24)12-19(11-17)15-24/h3-4,9,17-19H,2,5-8,10-15H2,1H3,(H,25,28)(H,26,27) |
InChIKey | YXADKMPRWFBOHW-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1)S(=O)(=O)N=C(N2)CCC(=O)NCCCOC34CC5CC(C3)CC(C5)C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |