For research use only. Not for therapeutic Use.
BTSA1（Cat No.:I014278） is a potent activator of the BAX protein, a key regulator of apoptosis (programmed cell death). It exhibits high affinity and specificity for the N-terminal activation site of BAX, leading to conformational changes that trigger BAX-mediated apoptosis. BTSA1 has shown significant efficacy in promoting apoptosis specifically in leukemia cell lines and patient samples, while sparing healthy cells.
| Catalog Number | I014278 |
| CAS Number | 314761-14-3 |
| Synonyms | BTSA1;1H-Pyrazole-4,5-dione, 3-phenyl-1-(4-phenyl-2-thiazolyl)-, 4-[2-(2-thiazolyl)hydrazone] |
| Molecular Formula | C21H14N6OS2 |
| Purity | ≥95% |
| Target | Bcl-2 Family |
| Solubility | Soluble in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-4-(1,3-thiazol-2-yldiazenyl)-1H-pyrazol-3-one |
| InChI | InChI=1S/C21H14N6OS2/c28-19-18(24-25-20-22-11-12-29-20)17(15-9-5-2-6-10-15)26-27(19)21-23-16(13-30-21)14-7-3-1-4-8-14/h1-13,26H |
| InChIKey | CTRCXGFSYFTJIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)N3C(=O)C(=C(N3)C4=CC=CC=C4)N=NC5=NC=CS5 |
| Reference | </br>[1] Reyna DE, et al. Cancer Cell. 2017, 32(4):490-505.</br> |
