For research use only. Not for therapeutic Use.
BTTAA (Cat No.:I001275) is a bioconjugation reagent used in click chemistry, particularly for copper-catalyzed azide-alkyne cycloaddition (CuAAC) reactions. It enhances the efficiency and specificity of these reactions, enabling the labeling and modification of biomolecules with high precision. BTTAA is valued for its ability to stabilize the copper catalyst, reducing side reactions and increasing yield. Its high purity and reliability make it indispensable in biochemistry and molecular biology research, facilitating the development of novel diagnostics, therapeutics, and biomolecular probes.
| Catalog Number | I001275 |
| CAS Number | 1334179-85-9 |
| Molecular Formula | C19H30N10O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[[bis[(1-tert-butyltriazol-4-yl)methyl]amino]methyl]triazol-1-yl]acetic acid |
| InChI | InChI=1S/C19H30N10O2/c1-18(2,3)28-11-15(21-24-28)8-26(7-14-10-27(23-20-14)13-17(30)31)9-16-12-29(25-22-16)19(4,5)6/h10-12H,7-9,13H2,1-6H3,(H,30,31) |
| InChIKey | MGQYHUDOWOGSQI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=C(N=N1)CN(CC2=CN(N=N2)CC(=O)O)CC3=CN(N=N3)C(C)(C)C |
