For research use only. Not for therapeutic Use.
BTUM (Bis-Thiourea-Mercury complex)(CAT: R063138) is a chemical compound that involves the coordination of mercury ions with thiourea ligands. It is often studied for its potential applications in materials science, particularly in the development of sensors, catalysts, and other coordination complexes. The strong affinity of thiourea for metal ions, such as mercury, allows for the formation of stable complexes, which are of interest in both environmental and industrial settings. BTUM may also be researched for its potential use in mercury ion detection or sequestration, due to the toxicological importance of mercury in environmental pollution.
Catalog Number | R063138 |
CAS Number | 151882-81-4 |
Synonyms | 4,4’-Bis(p-toluenesulfonylaminocarbonylamino)diphenylmethane; 4,4’-Bis(p-toluenesulfonylaminocarboxylamino)diphenylmethane; 4,4’-Bis(p-tolylsulfonylureido)diphenylmethane; N,N’-[methylenebis(4,1-phenyleneiminocarbonyl)]bis[4-methyl-Benzenesulfonamide |
Molecular Formula | C29H28N4O6S2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-[4-[[4-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]urea |
InChI | InChI=1S/C29H28N4O6S2/c1-20-3-15-26(16-4-20)40(36,37)32-28(34)30-24-11-7-22(8-12-24)19-23-9-13-25(14-10-23)31-29(35)33-41(38,39)27-17-5-21(2)6-18-27/h3-18H,19H2,1-2H3,(H2,30,32,34)(H2,31,33,35) |
InChIKey | XVSRGZPKJKLORS-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CC=C(C=C2)CC3=CC=C(C=C3)NC(=O)NS(=O)(=O)C4=CC=C(C=C4)C |