For research use only. Not for therapeutic Use.
BTZO-1 could bind to macrophage migration inhibitory factor ( MIF ) with Kd value of 6Chemicalbook8.6 nM. BTZO-1 starvation activates antioxidant response element ( ARE ) -mediated gene expression and inhibits oxidative stress-induced cardiomyocyte apoptosis in vitro.
| Catalog Number | I010910 |
| CAS Number | 99420-15-2 |
| Synonyms | 2-(2-Pyridinyl)-4H-1,3-benzothiazin-4-one |
| Molecular Formula | C13H8N2OS |
| Purity | ≥95% |
| Solubility | Soluble to 20 mM in DMSO with gentle warming |
| Storage | 2-8°C |
| IUPAC Name | 2-pyridin-2-yl-1,3-benzothiazin-4-one |
| InChI | InChI=1S/C13H8N2OS/c16-12-9-5-1-2-7-11(9)17-13(15-12)10-6-3-4-8-14-10/h1-8H |
| InChIKey | GBAKVEWPYUIGHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N=C(S2)C3=CC=CC=N3 |
