For research use only. Not for therapeutic Use.
BU08028(CAT: I005142) is a mixed opioid receptor agonist and antagonist, primarily targeting the mu, delta, and kappa opioid receptors, as well as the nociceptin/orphanin FQ receptor (NOP receptor). It is being researched for its analgesic properties, with the potential to provide pain relief without the harmful side effects commonly associated with traditional opioids, such as respiratory depression and addiction. BU08028 has shown promise in preclinical studies for producing effective pain management while minimizing the risk of abuse and dependence. Its dual activity at multiple opioid receptors makes it a candidate for developing safer opioid-based treatments for pain.
| Catalog Number | I005142 |
| CAS Number | 1333904-22-5 |
| Synonyms | BU08028; BU 08028; BU-08028.;(2S)-2-[(5R,6R,7R,14S)-N-cyclopropylmethyl-4,5-epoxy-6,14-ethano-3-hydroxy-6-methoxymorphinan-7-yl]-3,3-dimethylpentan-2-ol |
| Molecular Formula | C30H43NO4 |
| Purity | ≥95% |
| Target | MOP Receptor Agonist |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| InChI | InChI=1S/C30H43NO4/c1-6-26(2,3)27(4,33)21-16-28-11-12-30(21,34-5)25-29(28)13-14-31(17-18-7-8-18)22(28)15-19-9-10-20(32)24(35-25)23(19)29/h9-10,18,21-22,25,32-33H,6-8,11-17H2,1-5H3/t21-,22-,25-,27+,28-,29+,30-/m1/s1 |
| InChIKey | HBENZIXOGRCSQN-VQWWACLZSA-N |
| SMILES | C[C@](O)([C@@H]1[C@](OC)(CC2)[C@@]3([H])[C@]45C6=C(O3)C(O)=CC=C6C[C@@H](N(CC7CC7)CC5)[C@@]42C1)C(C)(C)CC |
