For research use only. Not for therapeutic Use.
Buclizine(CAT: I014280) is a first-generation antihistamine and anticholinergic agent belonging to the piperazine class. It primarily acts as a H1 receptor antagonist, reducing histamine-mediated allergic responses and exerting a sedative effect. Buclizine is widely used to treat motion sickness, nausea, and vertigo, as well as for managing mild allergic reactions. Its anticholinergic properties contribute to its efficacy in addressing vestibular disturbances. Additionally, Buclizine has been employed as an appetite stimulant in certain clinical settings. Its pharmacological profile makes it a useful compound in neurology and pharmacology research, particularly for studying histaminergic and cholinergic pathways and their role in motion-related disorders.
| Catalog Number | I014280 |
| CAS Number | 82-95-1 |
| Synonyms | Buclizine; Histabutizine; Histabutyzine;Piperazine, 1-((4-chlorophenyl)phenylmethyl)-4-((4-(1,1-dimethylethyl)phenyl)methyl)- (9CI) |
| Molecular Formula | C28H33ClN2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-4-[(4-chlorophenyl)-phenylmethyl]piperazine |
| InChI | InChI=1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
| InChIKey | MOYGZHXDRJNJEP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(CN2CCN(C(C3=CC=C(Cl)C=C3)C4=CC=CC=C4)CC2)C=C1)(C)C |
