For research use only. Not for therapeutic Use.
Bufotalin(CAT: I003633)is a naturally occurring cardiac glycoside that is derived from the venom of certain toad species, including Bufo bufo gargarizans and Bufo bufo gargarizans Cantor. It exhibits various pharmacological properties, including cardiotonic, anticancer, and antimicrobial effects. Bufotalin acts by inhibiting Na+/K+-ATPase, an enzyme responsible for maintaining the sodium and potassium ion balance in cells. By inhibiting this enzyme, bufotalin increases intracellular calcium levels, leading to enhanced cardiac contractility. Additionally, bufotalin has been studied for its potential anticancer activity, as it can induce apoptosis and inhibit cell proliferation in certain cancer cell lines. However, further research is needed to fully understand its mechanisms of action and potential therapeutic applications.
CAS Number | 471-95-4 |
Molecular Formula | C26H36O6 |
Purity | ≥95% |
Target | Immunology/Inflammation |
Solubility | DMSO: ≥ 4.6 mg/mL |
Storage | 3 years -20C powder |
IUPAC Name | [(3S,5R,8R,9S,10S,13R,14S,16S,17R)-3,14-dihydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate |
InChI | 1S/C26H36O6/c1-15(27)32-21-13-26(30)20-6-5-17-12-18(28)8-10-24(17,2)19(20)9-11-25(26,3)23(21)16-4-7-22(29)31-14-16/h4,7,14,17-21,23,28,30H,5-6,8-13H2,1-3H3/t17-,18+,19+,20-,21+,23+,24+,25-,26+/m1/s1 |
InChIKey | VOZHMAYHYHEWBW-NVOOAVKYSA-N |
SMILES | CC(=O)O[C@H]1C[C@@]2([C@@H]3CC[C@@H]4C[C@H](CC[C@@]4([C@H]3CC[C@@]2([C@H]1C5=COC(=O)C=C5)C)C)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |