For research use only. Not for therapeutic Use.
Buparvaquone（Cat No.:I005310）is a second-generation hydroxynaphthoquinone used to treat protozoal infections, particularly Theileria species, which cause theileriosis in cattle. It works by inhibiting the mitochondrial electron transport chain of the parasite, disrupting energy production and leading to its death. Buparvaquone is highly effective against both intracellular and extracellular stages of Theileria, making it a preferred treatment in endemic regions. Its targeted action minimizes host toxicity, ensuring animal health and productivity. Buparvaquone is an essential tool in veterinary medicine for managing economically significant parasitic diseases.
| Catalog Number | I005310 |
| CAS Number | 88426-33-9 |
| Synonyms | BW 720C |
| Molecular Formula | C21H26O3 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 3-[(4-tert-butylcyclohexyl)methyl]-4-hydroxynaphthalene-1,2-dione |
| InChI | InChI=1S/C21H26O3/c1-21(2,3)14-10-8-13(9-11-14)12-17-18(22)15-6-4-5-7-16(15)19(23)20(17)24/h4-7,13-14,22H,8-12H2,1-3H3 |
| InChIKey | NEGDTWQGGLJCTL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(CC1)CC2=C(C3=CC=CC=C3C(=O)C2=O)O |
| Reference | <p style=/line-height:25px/> |
