For research use only. Not for therapeutic Use.
N-Propan-2-ylbutanamide(CAT: M137406) is a high-purity aliphatic amide widely utilized in pharmaceutical and chemical research. Featuring a butanamide backbone with an isopropyl group attached to the nitrogen atom, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, fine chemicals, and specialty materials. Its simple yet functional structure is valuable in medicinal chemistry for developing therapeutic agents and exploring structure-activity relationships. With excellent stability and reactivity, N-Propan-2-ylbutanamide ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
CAS Number | 122348-67-8 |
Molecular Formula | C7H15NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-propan-2-ylbutanamide |
InChI | InChI=1S/C7H15NO/c1-4-5-7(9)8-6(2)3/h6H,4-5H2,1-3H3,(H,8,9) |
InChIKey | KKWNADDVIBLENW-UHFFFAOYSA-N |
SMILES | CCCC(=O)NC(C)C |