For research use only. Not for therapeutic Use.
Butanamide, N,N-bis(2-ethylhexyl)-(Cat No.:L002417)is an organic compound featuring a butanamide core with two 2-ethylhexyl groups attached to the nitrogen atom. This compound is commonly used as a plasticizer, surfactant, or dispersing agent in various industrial applications, such as polymers and coatings. Its long alkyl chains impart flexibility and improve the handling properties of materials. In chemical research and industrial processes, it plays a role in enhancing the solubility, stability, and performance of products, making it valuable in formulations for plastics, lubricants, and other specialty chemicals.
CAS Number | 112724-94-4 |
Molecular Formula | C20H41NO |
Purity | ≥95% |
IUPAC Name | N,N-bis(2-ethylhexyl)butanamide |
InChI | InChI=1S/C20H41NO/c1-6-11-14-18(9-4)16-21(20(22)13-8-3)17-19(10-5)15-12-7-2/h18-19H,6-17H2,1-5H3 |
InChIKey | ZXHLGQVRYKTEHM-UHFFFAOYSA-N |
SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)CCC |