For research use only. Not for therapeutic Use.
Butin is a natural flavonoid compound found in plants like Styrax species and Rhus verniciflua. It belongs to the flavonol subclass of flavonoids and is characterized by its structure with hydroxyl groups on the B ring. Butin exhibits antioxidant and anti-inflammatory properties and has potential therapeutic benefits, including in skin care and as a dietary supplement. Research suggests its role in promoting health and as a natural remedy for various ailments due to its bioactive properties.
| Catalog Number | R055944 |
| CAS Number | 492-14-8 |
| Molecular Formula | C15H12O5 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C15H12O5/c16-9-2-3-10-12(18)7-14(20-15(10)6-9)8-1-4-11(17)13(19)5-8/h1-6,14,16-17,19H,7H2/t14-/m0/s1 |
| InChIKey | MJBPUQUGJNAPAZ-AWEZNQCLSA-N |
| SMILES | C1C(OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C=C3)O)O |
