For research use only. Not for therapeutic Use.
Butylhydroxyanisole (Cat No.:I002849) is a food additive preservative that acts as an antioxidant. It is composed of a mixture of two isomeric organic compounds. BHA is commonly used in the food industry to prevent spoilage and maintain the quality of various products. It works by inhibiting the oxidation of fats and oils, thereby extending the shelf life of foods. BHA is particularly effective in preventing rancidity in processed foods, such as snacks, cereals, and baked goods. Its antioxidant properties make it a valuable ingredient in preserving the freshness and stability of food products.
| Catalog Number | I002849 |
| CAS Number | 25013-16-5 |
| Molecular Formula | C11H16O2 |
| Purity | 98% |
| Solubility | 10 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 2-tert-butyl-4-methoxyphenol |
| InChI | InChI=1S/C11H16O2/c1-11(2,3)9-7-8(13-4)5-6-10(9)12/h5-7,12H,1-4H3 |
| InChIKey | MRBKEAMVRSLQPH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)OC)O |
| Reference | <p> |
