For research use only. Not for therapeutic Use.
Butyramidine Hydrochloride(CAT: L047271) is a high-purity chemical compound featuring an amidine functional group, commonly utilized in pharmaceutical and biochemical research. As a hydrochloride salt, it offers enhanced stability and solubility, making it ideal for use in aqueous systems. This compound serves as a versatile intermediate in the synthesis of bioactive molecules, particularly in the development of pharmaceuticals and agrochemicals. Butyramidine Hydrochloride is also employed in studies of enzyme inhibitors and receptor binding due to its unique structural properties. With reliable performance and consistent quality, it is a valuable reagent for advancing research in medicinal chemistry and drug discovery.
CAS Number | 3020-81-3 |
Molecular Formula | C4H11ClN2 |
Purity | ≥95% |
IUPAC Name | butanimidamide;hydrochloride |
InChI | InChI=1S/C4H10N2.ClH/c1-2-3-4(5)6;/h2-3H2,1H3,(H3,5,6);1H |
InChIKey | STYCVEYASXULRN-UHFFFAOYSA-N |
SMILES | CCCC(=N)N.Cl |