For research use only. Not for therapeutic Use.
Butyrolactone 3 is a chemical compound classified as a lactone, characterized by a four-membered ring structure. It is used as a solvent and intermediate in organic synthesis. This compound plays a significant role in the production of pharmaceuticals, agrochemicals, and various industrial chemicals, showcasing its versatility and importance in chemical research and manufacturing processes.
CAS Number | 778649-18-6 |
Synonyms | (2R,3S)-rel-Tetrahydro-4-methylene-5-oxo-2-propyl-3-furancarboxylic Acid; 4-Methylene-5-oxo-2-propyl-tetrahydrofuran-3-carboxylic Acid; |
Molecular Formula | C9H12O4 |
Purity | ≥95% |
Target | Histone Acetyltransferase |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | (2S,3R)-4-methylidene-5-oxo-2-propyloxolane-3-carboxylic acid |
InChI | InChI=1S/C9H12O4/c1-3-4-6-7(8(10)11)5(2)9(12)13-6/h6-7H,2-4H2,1H3,(H,10,11)/t6-,7+/m0/s1 |
InChIKey | SRQUTZJZABSZRQ-NKWVEPMBSA-N |
SMILES | CCCC1C(C(=C)C(=O)O1)C(=O)O |