For research use only. Not for therapeutic Use.
BV02（Cat No.:I023876）is a selective inhibitor of the enzyme Bruton’s tyrosine kinase (BTK), which plays a crucial role in B-cell signaling and immune responses. By inhibiting BTK, BV02 suppresses the activation of B-cells and the production of inflammatory cytokines, making it a potential therapeutic agent for autoimmune diseases such as rheumatoid arthritis and lupus, as well as certain types of blood cancers like B-cell malignancies. BV02’s targeted action on BTK provides a promising approach for modulating immune responses and improving the treatment of immune-mediated diseases and cancers.
| CAS Number | 292870-53-2 |
| Synonyms | 2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1,3-dioxoisoindole-5-carboxylic acid |
| Molecular Formula | C20H15N3O5 |
| Purity | ≥95% |
| IUPAC Name | 2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChI | InChI=1S/C20H15N3O5/c1-11-16(19(26)23(21(11)2)13-6-4-3-5-7-13)22-17(24)14-9-8-12(20(27)28)10-15(14)18(22)25/h3-10H,1-2H3,(H,27,28) |
| InChIKey | ZFYSDSINNOLWGO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N3C(=O)C4=C(C3=O)C=C(C=C4)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
