For research use only. Not for therapeutic Use.
BW 245C(Cat No.:I011763) is a powerful prostanoid DP-receptor (DP1) agonist widely utilized in stroke and disease research. By selectively activating the DP1 receptor, it elicits specific cellular responses and physiological effects. Its use as an experimental tool allows scientists to study the receptor’s role and potential therapeutic benefits in stroke and other diseases. Understanding its pharmacological properties and effects on DP1 receptors can contribute to the development of targeted treatments and advance our knowledge of the molecular pathways involved in various pathological conditions.
CAS Number | 72814-32-5 |
Synonyms | (4S)-(3-[(3R,S)-3-cyclohexyl-3-hydroxypropyl]-2,5-dioxo)-4-imidazolidineheptanoic acid |
Molecular Formula | C19H32N2O5 |
Purity | ≥95% |
Target | Prostaglandin Receptor |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 7-[(4S)-3-[(3R)-3-cyclohexyl-3-hydroxypropyl]-2,5-dioxoimidazolidin-4-yl]heptanoic acid |
InChI | InChI=1S/C19H32N2O5/c22-16(14-8-4-3-5-9-14)12-13-21-15(18(25)20-19(21)26)10-6-1-2-7-11-17(23)24/h14-16,22H,1-13H2,(H,23,24)(H,20,25,26)/t15-,16+/m0/s1 |
InChIKey | ZIDQIOZJEJFMOH-JKSUJKDBSA-N |
SMILES | C1CCC(CC1)C(CCN2C(C(=O)NC2=O)CCCCCCC(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |