For research use only. Not for therapeutic Use.
BX-912（Cat No.:I004636）is a potent and selective inhibitor of PDK1 (3-Phosphoinositide-Dependent Protein Kinase-1), a key kinase involved in the PI3K/Akt signaling pathway. By inhibiting PDK1, BX-912 effectively suppresses downstream activation of Akt, leading to reduced cell growth, survival, and proliferation. It is particularly useful for studying cancers with hyperactive PI3K/Akt signaling, as this pathway is often dysregulated in many tumor types. BX-912 is valuable for cancer research, enabling the exploration of PDK1’s role in tumorigenesis and providing insights into potential therapeutic strategies targeting the PI3K/Akt pathway.
| Catalog Number | I004636 |
| CAS Number | 702674-56-4 |
| Synonyms | N-[3-[[5-bromo-4-[2-(1H-imidazol-5-yl)ethylamino]pyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide |
| Molecular Formula | C20H23BrN8O |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | DMSO > 60 mg/ml; Water < 1 mg/ml |
| Storage | -20°C |
| IC50 | 12 nM |
| IUPAC Name | N-[3-[[5-bromo-4-[2-(1H-imidazol-5-yl)ethylamino]pyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide |
| InChI | InChI=1S/C20H23BrN8O/c21-17-12-24-19(28-18(17)23-7-6-16-11-22-13-25-16)26-14-4-3-5-15(10-14)27-20(30)29-8-1-2-9-29/h3-5,10-13H,1-2,6-9H2,(H,22,25)(H,27,30)(H2,23,24,26,28) |
| InChIKey | DMMILYKXNCVKOJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)NC2=CC=CC(=C2)NC3=NC=C(C(=N3)NCCC4=CN=CN4)Br |
| Reference | <p style=/line-height:25px/> |
