For research use only. Not for therapeutic Use.
C-di-AMP (Cat.No:I004002) is a second messenger molecule found in bacteria, primarily involved in regulating cellular processes like cell wall synthesis, stress response, and virulence. It plays a crucial role in bacterial signaling by interacting with various proteins and enzymes to maintain cellular homeostasis. In some bacteria, c-di-AMP also modulates immune responses in host organisms. As a target for antibacterial drug development, it holds potential for treating infections caused by c-di-AMP-producing pathogens.
Catalog Number | I004002 |
CAS Number | 54447-84-6 |
Synonyms | c-di-AMP;Cyclic di-Adenosine monophosphate;3/’,5/’-Cyclic diadenylic acid;Cyclic diadenylate |
Molecular Formula | C20H24N10O12P2 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | (1S,6R,8R,9R,10S,15R,17R,18R)-8,17-bis(6-aminopurin-9-yl)-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.3.0.06,10]octadecane-9,18-diol |
InChI | InChI=1S/C20H24N10O12P2/c21-15-9-17(25-3-23-15)29(5-27-9)19-11(31)13-7(39-19)1-37-43(33,34)42-14-8(2-38-44(35,36)41-13)40-20(12(14)32)30-6-28-10-16(22)24-4-26-18(10)30/h3-8,11-14,19-20,31-32H,1-2H2,(H,33,34)(H,35,36)(H2,21,23,25)(H2,22,24,26)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
InChIKey | PDXMFTWFFKBFIN-XPWFQUROSA-N |
SMILES | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(OC[C@@H]5[C@H]([C@H]([C@@H](O5)N6C=NC7=C(N=CN=C76)N)O)OP(=O)(O1)O)O |