For research use only. Not for therapeutic Use.
c-Fms-IN-13(Cat No.:I042756)is a selective small molecule inhibitor targeting the c-Fms receptor, also known as colony-stimulating factor 1 receptor (CSF1R). This receptor plays a crucial role in the development and function of macrophages and monocytes, influencing immune responses and inflammation. By inhibiting c-Fms, c-Fms-IN-13 aims to modulate macrophage activity, which could be beneficial in treating various inflammatory diseases and cancer. It is also being investigated for its potential to disrupt the tumor microenvironment by altering immune cell infiltration.
CAS Number | 885704-58-5 |
Synonyms | 5-cyano-N-[2,4-di(piperidin-1-yl)phenyl]furan-2-carboxamide |
Molecular Formula | C22H26N4O2 |
Purity | ≥95% |
IUPAC Name | 5-cyano-N-[2,4-di(piperidin-1-yl)phenyl]furan-2-carboxamide |
InChI | InChI=1S/C22H26N4O2/c23-16-18-8-10-21(28-18)22(27)24-19-9-7-17(25-11-3-1-4-12-25)15-20(19)26-13-5-2-6-14-26/h7-10,15H,1-6,11-14H2,(H,24,27) |
InChIKey | QSPUWGIYPBXIJO-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)C2=CC(=C(C=C2)NC(=O)C3=CC=C(O3)C#N)N4CCCCC4 |