For research use only. Not for therapeutic Use.
C-Methylcalix[4]resorcinarene(CAT: L000518) is a significant chemical compound with applications in various fields, including supramolecular chemistry and material science. Its action method primarily involves its role as a host molecule for binding guest compounds within its cavity. In supramolecular chemistry, it acts as a molecular container, forming host-guest complexes with various organic and inorganic molecules.
Catalog Number | L000518 |
CAS Number | 65338-98-9 |
Molecular Formula | C32H32O8 |
Purity | ≥95% |
IUPAC Name | 2,8,14,20-tetramethylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol |
InChI | InChI=1S/C32H32O8/c1-13-17-5-19(27(35)9-25(17)33)14(2)21-7-23(31(39)11-29(21)37)16(4)24-8-22(30(38)12-32(24)40)15(3)20-6-18(13)26(34)10-28(20)36/h5-16,33-40H,1-4H3 |
InChIKey | WGDNYTQTRISCMM-UHFFFAOYSA-N |