For research use only. Not for therapeutic Use.
C18 Ceramide is a type of ceramide, a lipid molecule composed of a sphingosine backbone linked to a fatty acid chain, in this case, an 18-carbon chain. Ceramides are important components of cell membranes, particularly in the skin, where they play a critical role in maintaining the barrier function and hydration. C18 ceramide is also involved in various cellular processes, such as apoptosis (programmed cell death), cell signaling, and inflammation.
Catalog Number | R001026 |
CAS Number | 2304-81-6 |
Synonyms | N-[(1S,2R,3E)-2-Hydroxy-1-(hydroxymethyl)-3-heptadecen-1-yl]octadecanamide; D-erythro-1,3-Dihydroxy-2-octadecanoylamido-trans-4-octadecene; N-Stearoyl-?C18-sphingosine; N-Stearoyl-D-erythro-sphingosine; N-Stearoyl-D-sphingosine; N-Stearoylsphingenine |
Molecular Formula | C36H71NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
InChI | InChI=1S/C36H71NO3/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-36(40)37-34(33-38)35(39)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h29,31,34-35,38-39H,3-28,30,32-33H2,1-2H3,(H,37,40)/b31-29+/t34-,35+/m0/s1 |
InChIKey | VODZWWMEJITOND-NXCSZAMKSA-N |
SMILES | CCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO)[C@@H](/C=C/CCCCCCCCCCCCC)O |