For research use only. Not for therapeutic Use.
C188-9 is a small-molecule inhibitor specifically targeting the STAT3 signaling pathway, which plays a crucial role in cancer cell survival, proliferation, and immune evasion. By inhibiting STAT3, C188-9 disrupts the transcription of genes involved in tumor growth and immune suppression, making it a promising candidate for cancer therapy. It has shown potential in preclinical studies for treating various cancers, including those resistant to conventional therapies. C188-9 is also being explored for its ability to enhance the effectiveness of other anticancer treatments.
CAS Number | 432001-19-9 |
Synonyms | N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-4-methoxybenzenesulfonamide |
Molecular Formula | C27H21NO5S |
Purity | ≥95% |
InChI | InChI=1S/C27H21NO5S/c1-33-18-11-13-19(14-12-18)34(31,32)28-24-16-23(27(30)22-9-5-4-8-21(22)24)26-20-7-3-2-6-17(20)10-15-25(26)29/h2-16,28-30H,1H3 |
InChIKey | QDCJDYWGYVPBDO-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C3=CC=CC=C32)O)C4=C(C=CC5=CC=CC=C54)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |