For research use only. Not for therapeutic Use.
C22-Ceramide(Cat No.:I041128)is a type of sphingolipid, a class of lipids that are essential components of cell membranes, particularly in the skin and nervous system. It consists of a sphingosine backbone linked to a fatty acid chain of 22 carbon atoms (C22). Ceramides, including C22-Ceramide, play a crucial role in regulating cell signaling, apoptosis, and the integrity of the skin barrier. It has been studied for its potential therapeutic applications in treating skin disorders, such as atopic dermatitis, and its role in cancer and neurodegenerative diseases, where ceramide metabolism is often dysregulated.
CAS Number | 27888-44-4 |
Synonyms | N-[(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]docosanamide |
Molecular Formula | C40H79NO3 |
Purity | ≥95% |
IUPAC Name | N-[(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]docosanamide |
InChI | InChI=1S/C40H79NO3/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-32-34-36-40(44)41-38(37-42)39(43)35-33-31-29-27-25-23-16-14-12-10-8-6-4-2/h33,35,38-39,42-43H,3-32,34,36-37H2,1-2H3,(H,41,44)/b35-33+/t38-,39+/m0/s1 |
InChIKey | KEPQASGDXIEOIL-GLQCRSEXSA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO)[C@@H](/C=C/CCCCCCCCCCCCC)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |