For research use only. Not for therapeutic Use.
C22 Dihydroceramide is a crucial sphingolipid that plays a significant role in cellular signaling and membrane structure. This compound, characterized by a long-chain fatty acid backbone, is involved in various biological processes, including cell growth, differentiation, and apoptosis. It serves as a precursor for ceramide synthesis, which is vital for maintaining cellular homeostasis and integrity. The study of C22 Dihydroceramide enhances our understanding of lipid metabolism and its implications in skin health and related disorders.
Catalog Number | R007142 |
CAS Number | 147492-65-7 |
Synonyms | N-[(1S,2R)-2-Hydroxy-1-(hydroxymethyl)-heptadecyl]-docosanamide; |
Molecular Formula | C40H81NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]docosanamide |
InChI | InChI=1S/C40H81NO3/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-32-34-36-40(44)41-38(37-42)39(43)35-33-31-29-27-25-23-16-14-12-10-8-6-4-2/h38-39,42-43H,3-37H2,1-2H3,(H,41,44)/t38-,39+/m0/s1 |
InChIKey | SXPRAKSDHOEHIG-ZESVVUHVSA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)NC(CO)C(CCCCCCCCCCCCCCC)O |