For research use only. Not for therapeutic Use.
C646（Cat No.:I003171）is a potent and selective inhibitor of the histone acetyltransferase (HAT) p300/CBP. This compound is widely used in epigenetic research to study gene expression regulation and chromatin remodeling. By inhibiting p300/CBP, C646 prevents the acetylation of histones, leading to altered transcriptional activity. It has shown potential in cancer research, where dysregulation of histone acetylation is often implicated. C646 is also used to explore the role of acetylation in various cellular processes, making it a valuable tool in the development of novel therapeutic strategies targeting epigenetic mechanisms.
| Catalog Number | I003171 |
| CAS Number | 328968-36-1 |
| Synonyms | 4-[(4Z)-4-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| Molecular Formula | C₂₄H₁₉N₃O₆ |
| Purity | ≥95% |
| Target | Histone Acetyltransferase; Autophagy; Epigenetic Reader Domain; Apoptosis |
| IC50 | 400 nM(Ki) |
| IUPAC Name | 4-[(4Z)-4-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| InChI | InChI=1S/C24H19N3O6/c1-13-10-20(21(27(31)32)11-14(13)2)22-9-8-18(33-22)12-19-15(3)25-26(23(19)28)17-6-4-16(5-7-17)24(29)30/h4-12H,1-3H3,(H,29,30)/b19-12- |
| InChIKey | HEKJYZZSCQBJGB-UNOMPAQXSA-N |
| SMILES | CC1=CC(=C(C=C1C)[N+](=O)[O-])C2=CC=C(O2)/C=C\3/C(=NN(C3=O)C4=CC=C(C=C4)C(=O)O)C |
