For research use only. Not for therapeutic Use.
Ca2+ channel agonist 1 (Cat No.: I001538) is a small molecule that selectively activates calcium channels, enhancing calcium ion influx into cells. By promoting the opening of voltage-gated calcium channels, CCA1 plays a role in modulating intracellular calcium levels, which are crucial for various cellular processes, including neurotransmitter release, muscle contraction, and signal transduction. CCA1 has potential therapeutic applications in treating disorders related to calcium signaling, including certain types of neurological and cardiovascular conditions.
CAS Number | 1402821-24-2 |
Molecular Formula | C19H26N6O |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 14.23 uM (EC50, Ca2+ channel) 3.34 uM (EC50, cdk2) |
IUPAC Name | (2R)-2-[[6-(benzylamino)-9-propylpurin-2-yl]amino]butan-1-ol |
InChI | InChI=1S/C19H26N6O/c1-3-10-25-13-21-16-17(20-11-14-8-6-5-7-9-14)23-19(24-18(16)25)22-15(4-2)12-26/h5-9,13,15,26H,3-4,10-12H2,1-2H3,(H2,20,22,23,24)/t15-/m1/s1 |
InChIKey | LKXPLOHGQSEPEM-OAHLLOKOSA-N |
SMILES | CCCN1C=NC2=C(N=C(N=C21)NC(CC)CO)NCC3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |