For research use only. Not for therapeutic Use.
Cabozantinib malate (XL184)(Cat No.:A000202)is a potent inhibitor of multiple receptor tyrosine kinases, including VEGFR, MET, and AXL, which are involved in tumor growth, angiogenesis, and metastasis. By targeting these kinases, cabozantinib disrupts critical signaling pathways, leading to the inhibition of cancer cell proliferation, migration, and the formation of new blood vessels. It is approved for treating various cancers, including renal cell carcinoma and medullary thyroid cancer. Cabozantinib’s broad activity across multiple targets makes it a promising therapy for addressing resistance mechanisms in advanced cancers.
CAS Number | 1140909-48-3 |
Synonyms | XL-184; XL184; XL 184; BMS907351; BMS 907351; BMS-907351; Cabozantinib malate; Cabozantinib S-malate. Brand name: Cometriq.;N-(4-((6,7-dimethoxyquinolin-4-yl)oxy)phenyl)-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (S)-2-hydroxysuccinate |
Molecular Formula | C32H30FN3O10 |
Purity | 99% |
Target | Apoptosis |
Solubility | >31.8mg/mL in DMSO |
Storage | 3 years -20C powder |
Analysis method | HPLC |
IUPAC Name | 1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;(2S)-2-hydroxybutanedioic acid |
InChI | InChI=1S/C28H24FN3O5.C4H6O5/c1-35-24-15-21-22(16-25(24)36-2)30-14-11-23(21)37-20-9-7-19(8-10-20)32-27(34)28(12-13-28)26(33)31-18-5-3-17(29)4-6-18;5-2(4(8)9)1-3(6)7/h3-11,14-16H,12-13H2,1-2H3,(H,31,33)(H,32,34);2,5H,1H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
InChIKey | HFCFMRYTXDINDK-WNQIDUERSA-N |
SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=C(C=C3)NC(=O)C4(CC4)C(=O)NC5=CC=C(C=C5)F.C([C@@H](C(=O)O)O)C(=O)O |