For research use only. Not for therapeutic Use.
Cadazolid(CAT: I005419) is a novel oxazolidinone-quinolone hybrid antibiotic developed for the treatment of Clostridioides difficile infections (CDI). It combines the ribosomal protein synthesis inhibition mechanism of oxazolidinones with the DNA synthesis inhibition of quinolones, making it highly effective against C. difficile and reducing the risk of resistance development. Cadazolid exhibits strong activity against C. difficile while having minimal impact on the normal gut flora, which is critical for preventing recurrent infections. Its dual mechanism of action and targeted effectiveness make it a promising option for managing CDI, a serious and sometimes life-threatening infection associated with antibiotic use.
| Catalog Number | I005419 |
| CAS Number | 1025097-10-2 |
| Synonyms | 1-cyclopropyl-6-fluoro-7-[4-[[2-fluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenoxy]methyl]-4-hydroxypiperidin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| Molecular Formula | C29H29F2N3O8 |
| Purity | ≥95% |
| InChI | InChI=1S/C29H29F2N3O8/c30-21-10-19-23(33(16-1-2-16)13-20(26(19)36)27(37)38)11-24(21)32-7-5-29(40,6-8-32)15-41-25-4-3-17(9-22(25)31)34-12-18(14-35)42-28(34)39/h3-4,9-11,13,16,18,35,40H,1-2,5-8,12,14-15H2,(H,37,38)/t18-/m1/s1 |
| InChIKey | XWFCFMXQTBGXQW-GOSISDBHSA-N |
| SMILES | C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCC(CC4)(COC5=C(C=C(C=C5)N6CC(OC6=O)CO)F)O)F)C(=O)O |
