For research use only. Not for therapeutic Use.
CADP-Ribose(Cat No.:M018858)is a high-purity metabolite vital in biochemical and pharmacological research. It is a key player in cellular signaling pathways, particularly in the regulation of calcium ion channels and intracellular calcium release. CADP-Ribose is crucial for studying processes like cell proliferation, apoptosis, and metabolism. Its precise activity makes it essential for exploring therapeutic targets in diseases such as cancer, neurodegenerative disorders, and cardiovascular diseases. This compound’s broad applications in cellular and molecular biology research underscore its importance in advancing scientific knowledge and drug development.
Catalog Number | M018858 |
CAS Number | 119340-53-3 |
Synonyms | cADP-Ribose;cADPR |
Molecular Formula | C15H21N5O13P2 |
Purity | ≥95% |
Target | Membrane Transporter/Ion Channel |
Storage | -80°C |
IUPAC Name | (2R,3R,4S,5R,13R,14S,15R,16R)-8,10-dihydroxy-24-imino-8,10-dioxo-7,9,11,25,26-pentaoxa-1,17,19,22-tetraza-8λ5,10λ5-diphosphapentacyclo[18.3.1.12,5.113,16.017,21]hexacosa-18,20,22-triene-3,4,14,15-tetrol |
InChI | InChI=1S/C15H21N5O13P2/c16-12-7-13-18-4-19(12)14-10(23)8(21)5(31-14)1-29-34(25,26)33-35(27,28)30-2-6-9(22)11(24)15(32-6)20(13)3-17-7/h3-6,8-11,14-16,21-24H,1-2H2,(H,25,26)(H,27,28)/t5-,6-,8-,9-,10-,11-,14-,15-/m1/s1 |
InChIKey | BQOHYSXSASDCEA-KEOHHSTQSA-N |
SMILES | C1C2C(C(C(O2)N3C=NC4=C3N=CN(C4=N)C5C(C(C(O5)COP(=O)(OP(=O)(O1)O)O)O)O)O)O |