For research use only. Not for therapeutic Use.
Cadrofloxacin（Cat No.:M104049）is a synthetic fluoroquinolone antibiotic known for its broad-spectrum activity against gram-positive and gram-negative bacteria. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes crucial for DNA replication and transcription, ultimately leading to bacterial cell death. Cadrofloxacin is primarily studied for treating respiratory, urinary tract, and skin infections. Due to its potency and effectiveness, it holds promise in managing antibiotic-resistant infections. Ongoing research explores its pharmacokinetics, safety profile, and potential as a valuable option in both clinical and veterinary medicine.
| Catalog Number | M104049 |
| CAS Number | 153808-85-6 |
| Molecular Formula | C19H20F3N3O4 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | Desiccate at +4C |
| IUPAC Name | 1-cyclopropyl-8-(difluoromethoxy)-6-fluoro-7-[(3S)-3-methylpiperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| InChI | InChI=1S/C19H20F3N3O4/c1-9-7-24(5-4-23-9)15-13(20)6-11-14(17(15)29-19(21)22)25(10-2-3-10)8-12(16(11)26)18(27)28/h6,8-10,19,23H,2-5,7H2,1H3,(H,27,28)/t9-/m0/s1 |
| InChIKey | QBDBUKJBJJWZMG-VIFPVBQESA-N |
| SMILES | CC1CN(CCN1)C2=C(C=C3C(=C2OC(F)F)N(C=C(C3=O)C(=O)O)C4CC4)F |
