For research use only. Not for therapeutic Use.
Caffeic acid(CAT: R013839) holds significance in the realm of natural organic compounds. As a hydroxycinnamic acid, it is a naturally occurring compound found in various plant sources. Caffeic acid exhibits antioxidant properties and is known for its potential health benefits, including anti-inflammatory and anti-cancer effects. Its presence in plants contributes to their defense against environmental stressors.
CAS Number | 331-39-5 |
Synonyms | 3-(3,4-Dihydroxyphenyl)-2-propenoic Acid; 3,4-Dihydroxycinnamic Acid; 3,4-Dihydroxybenzeneacrylic Acid; 3-(3,4-Dihydroxyphenyl)-2-propenoic Acid; 4-(2-Carboxyethenyl)-1,2-dihydroxybenzene; NSC 57197; NSC 623438; |
Molecular Formula | C₉H₈O₄ |
Purity | 98% |
Target | Neuronal Signaling |
Appearance | White solid |
Storage | 3 years -20C powder |
Analysis method | HPLC |
InChI | InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+ |
InChIKey | QAIPRVGONGVQAS-DUXPYHPUSA-N |
SMILES | C1=CC(=C(C=C1C=CC(=O)O)O)O |