For research use only. Not for therapeutic Use.
Caffeine-d9(Cat No.: R006683) is a deuterated form of caffeine, essential for advanced pharmacological and biochemical research. This isotopically labeled compound, featuring nine deuterium atoms, is used to study the pharmacokinetics, metabolism, and physiological effects of caffeine. Its stable isotope labeling ensures precise and reliable analytical results. Caffeine-d9 is highly valued for its purity and stability, making it a crucial tool in drug development, toxicology studies, and the exploration of caffeine’s impact on health and human performance.
CAS Number | 72238-85-8 |
Synonyms | 3,7-Dihydro-1,3,7-(trimethyl-d9)-1H-purine-2,6-dione; 1,3,7-Trimethylxanthine-d9; 7-Methyltheophylline-d9; Alert-Pep-d9; Cafalgine-d9; Cafeina-d9; Caffedrine-d9; Caffein-d9; Cafipel-d9; DHCplus-d9; Dasin-d9; Diurex-d9; Durvitan-d9; Guaranine-d9; Hyco |
Molecular Formula | C8H10N4O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,3,7-tris(trideuteriomethyl)purine-2,6-dione |
InChI | InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3/i1D3,2D3,3D3 |
InChIKey | RYYVLZVUVIJVGH-GQALSZNTSA-N |
SMILES | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |