For research use only. Not for therapeutic Use.
Cajanin is a bioactive isoflavone compound found in pigeon pea (Cajanus cajan), a leguminous plant. This natural compound exhibits various pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities. Cajanin has been investigated for its potential therapeutic benefits in managing oxidative stress-related disorders and inflammatory conditions. Research on cajanin aims to elucidate its molecular mechanisms of action and explore its use in developing novel treatments for diseases such as cancer and cardiovascular disorders.
| Catalog Number | R053005 |
| CAS Number | 32884-36-9 |
| Molecular Formula | C16H12O6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-5-hydroxy-7-methoxychromen-4-one |
| InChI | InChI=1S/C16H12O6/c1-21-9-5-13(19)15-14(6-9)22-7-11(16(15)20)10-3-2-8(17)4-12(10)18/h2-7,17-19H,1H3 |
| InChIKey | ALFNTRJPGFNJQV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC=C(C2=O)C3=C(C=C(C=C3)O)O)O |
