For research use only. Not for therapeutic Use.
Calcein mixture of isomers is a calcium-dependent fluorescent molecule. Calcein mixture of isomers can be used to study bone metabolism (in vivo) and to stain depressed areas (in vitro). Calcein mixture of isomers can also be used for fluorometry and EDTA titration of calcium.
| Catalog Number | R019361 |
| CAS Number | 154071-48-4 |
| Synonyms | 2-[carboxymethyl(ethyl)amino]acetic acid;3′,6′-dihydroxyspiro[2-benzofuran-3,9′-xanthene]-1-one |
| Molecular Formula | C30H26N2O13 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H12O5.2C6H11NO4/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;2*1-2-7(3-5(8)9)4-6(10)11/h1-10,21-22H;2*2-4H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | FNXQHNHHHBGANT-UHFFFAOYSA-N |
| SMILES | CCN(CC(=O)O)CC(=O)O.CCN(CC(=O)O)CC(=O)O.C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
