Calcium Acetate is a high-purity compound used in pharmaceutical, biochemical, and industrial applications. This calcium salt is essential for studying calcium metabolism, as a phosphate binder in renal disease treatments, and in the production of various chemicals. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced biochemical research, pharmaceutical formulations, and industrial processes. Ideal for experimental setups, Calcium Acetate enhances research accuracy and efficiency.
| Catalog Number | R022732 |
| CAS Number | 62-54-4 |
| Synonyms | Calcium Acetate; Brown Acetate; Calcium Diacetate; E 263; Gray Acetate; Lime Acetate; Lime Pyrolignite; PhosLo; Royen; Sanopan; Sorbo-Calcion; Teltozan |
| Molecular Formula | Anhydrous:C4H6O4Ca |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | calcium;diacetate |
| InChI | InChI=1S/2C2H4O2.Ca/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | VSGNNIFQASZAOI-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Ca+2] |
