For research use only. Not for therapeutic Use.
Calcium carbide (Cat.No:R071172) is a chemical compound produced through the reaction of calcium oxide and carbon. It is commonly used in the production of acetylene gas through hydrolysis, which has various industrial applications, including welding and metal cutting. Calcium carbide is also utilized in the synthesis of organic compounds and as a ripening agent for fruits.
| Catalog Number | R071172 |
| CAS Number | 75-20-7 |
| Synonyms | CaC2, Calcium acetylide |
| Molecular Formula | CaC2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | (2-acetyloxy-3-phenoxypropyl) acetate |
| InChI | InChI=1S/C13H16O5/c1-10(14)16-8-13(18-11(2)15)9-17-12-6-4-3-5-7-12/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | MFUHTALWGBAVOL-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(COC1=CC=CC=C1)OC(=O)C |
