For research use only. Not for therapeutic Use.
Calcium carbonate (Cat.No:M049505) is a chemical compound found in various natural sources, including limestone, marble, and chalk. It is widely used as a dietary supplement, antacid, and calcium source in pharmaceuticals and as a filler, abrasive, and whitening agent in various industries, including cosmetics, paints, and plastics.
CAS Number | 1317-65-3 |
Molecular Formula | CaCO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | calcium;carbonate |
InChI | InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
InChIKey | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
SMILES | C(=O)([O-])[O-].[Ca+2] |