For research use only. Not for therapeutic Use.
Calcium Channel Antagonist 4(CAT: I040678) is a small-molecule inhibitor that selectively blocks voltage-gated calcium channels (VGCCs), thereby modulating calcium influx into excitable cells such as neurons and muscle fibers. By inhibiting calcium entry, it disrupts downstream signaling processes involved in neurotransmitter release, muscle contraction, and gene expression. Calcium Channel Antagonist 4 is commonly used in neurophysiological and cardiovascular research to study the role of calcium channels in pain, epilepsy, hypertension, and other calcium-dependent disorders. It serves as a valuable pharmacological tool for dissecting calcium channel function.
| CAS Number | 687574-49-8 |
| Synonyms | N-benzyl-3-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-benzofuran-2-carboxamide |
| Molecular Formula | C23H26N2O4S |
| Purity | ≥95% |
| IUPAC Name | N-benzyl-3-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-benzofuran-2-carboxamide |
| InChI | InChI=1S/C23H26N2O4S/c1-16-10-12-25(13-11-16)30(27,28)19-8-9-21-20(14-19)17(2)22(29-21)23(26)24-15-18-6-4-3-5-7-18/h3-9,14,16H,10-13,15H2,1-2H3,(H,24,26) |
| InChIKey | DVJRGJOPKYGOOQ-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)S(=O)(=O)C2=CC3=C(C=C2)OC(=C3C)C(=O)NCC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
