For research use only. Not for therapeutic Use.
Calcium D-Pantothenate is the calcium salt of pantothenic acid (vitamin B5), an essential nutrient involved in various metabolic processes. It plays a vital role in synthesizing coenzyme A, which is crucial for carbohydrate, protein, and fat metabolism. As a dietary supplement, Calcium D-Pantothenate is used to support energy production, adrenal function, and skin health. It is commonly included in multivitamin formulations and food fortification to prevent vitamin B5 deficiency, promoting overall health and well-being.
CAS Number | 137-08-6 |
Synonyms | D-Pantothenic Acid Calcium |
Molecular Formula | C18H32CaN2O10 |
Purity | ≥95% |
Target | Apoptosis |
Storage | Store at -20℃ |
IUPAC Name | calcium;3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoate |
InChI | 1S/2C9H17NO5.Ca/c2*1-9(2,5-11)7(14)8(15)10-4-3-6(12)13;/h2*7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13);/q;;+2/p-2/t2*7-;/m00./s1 |
InChIKey | FAPWYRCQGJNNSJ-UBKPKTQASA-L |
SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)[O-])O.CC(C)(CO)[C@H](C(=O)NCCC(=O)[O-])O.[Ca+2] |