For research use only. Not for therapeutic Use.
Calcium N5-methyltetrahydrofolate（Cat No.:I002909）is a bioactive form of folate, a B-vitamin essential for DNA synthesis, repair, and methylation. This compound serves as a key cofactor in the conversion of homocysteine to methionine, thereby playing a vital role in methylation processes crucial for cellular function and health. Its calcium salt form enhances stability and bioavailability, making it suitable for dietary supplements and therapeutic applications. Research suggests that N5-methyltetrahydrofolate may support cardiovascular health, cognitive function, and fetal development during pregnancy, highlighting its importance in nutritional and clinical settings.
| Catalog Number | I002909 |
| CAS Number | 26560-38-3 |
| Molecular Formula | C20H23CaN7O6 |
| Purity | ≥95% |
| Target | Antifolate |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | calcium;(2S)-2-[[4-[(2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioate |
| InChI | InChI=1S/C20H25N7O6.Ca/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29;/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31);/q;+2/p-2/t12?,13-;/m0./s1 |
| InChIKey | VWBBRFHSPXRJQD-ZEDZUCNESA-L |
| SMILES | CN1C(CNC2=C1C(=O)NC(=N2)N)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Ca+2] |
| Reference | <p style=/line-height:25px/> |
