For research use only. Not for therapeutic Use.
Calcium undecylenate(Cat No.:M049642) is a calcium salt of undecylenic acid, characterized by its formula C22H38CaO4. This white, powdery substance is notable for its antifungal properties and is commonly used in the treatment of skin infections, such as athlete’s foot. It functions by inhibiting the growth of fungi, providing an effective means of managing symptoms, and preventing the spread of infection. Additionally, calcium undecylenate finds applications in cosmetics and personal care products as a preservative and odor control agent, enhancing product stability and efficacy while maintaining skin health.
Catalog Number | M049642 |
CAS Number | 1322-14-1 |
Molecular Formula | C22H38CaO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | calcium;undec-10-enoate |
InChI | InChI=1S/2C11H20O2.Ca/c2*1-2-3-4-5-6-7-8-9-10-11(12)13;/h2*2H,1,3-10H2,(H,12,13);/q;;+2/p-2 |
InChIKey | CLOKKBBIKHZGNX-UHFFFAOYSA-L |
SMILES | C=CCCCCCCCCC(=O)[O-].C=CCCCCCCCCC(=O)[O-].[Ca+2] |