For research use only. Not for therapeutic Use.
Calmagite is a complexometric indicator which can be used to detect calcium and magnesium in various samples.
| Catalog Number | I012981 |
| CAS Number | 3147-14-6 |
| Synonyms | 3-hydroxy-4-[(2-hydroxy-5-methylphenyl)diazenyl]naphthalene-1-sulfonic acid |
| Molecular Formula | C17H14N2O5S |
| Purity | ≥95% |
| InChI | InChI=1S/C17H14N2O5S/c1-10-6-7-14(20)13(8-10)18-19-17-12-5-3-2-4-11(12)16(9-15(17)21)25(22,23)24/h2-9,20-21H,1H3,(H,22,23,24) |
| InChIKey | VBRNLOQCBCPPHL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)N=NC2=C(C=C(C3=CC=CC=C32)S(=O)(=O)O)O |
| Reference | [1]. Rasouli Z, et al. Simultaneously detection of calcium and magnesium in various samples by calmagite and chemometrics data processing. Spectrochim Acta A Mol Biomol Spectrosc. 2016 Dec 5;169:72-81. |
