For research use only. Not for therapeutic Use.
Calmidazolium chloride (Cat.No:I010581), also known as Calmidazolium, is a calcium-dependent protein kinase inhibitor that has shown potential as a therapeutic agent for various diseases such as cancer, cardiac hypertrophy, and stroke. It acts by inhibiting the calmodulin-mediated activation of calcium-dependent enzymes, leading to downstream effects. Calmidazolium chloride has also been shown to have antiviral properties against HIV-1 and other retroviruses. It is commonly used as a research tool in studying the role of calcium signaling in cellular processes.
| Catalog Number | I010581 |
| CAS Number | 57265-65-3 |
| Synonyms | Alternative Name: R 24571 |
| Molecular Formula | C31H23Cl7N2O |
| Purity | ≥95% |
| Target | Calcium Channel |
| Solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol |
| Storage | Store at 4℃ |
| IUPAC Name | 1-[bis(4-chlorophenyl)methyl]-3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-3-ium;chloride |
| InChI | InChI=1S/C31H23Cl6N2O.ClH/c32-23-6-1-20(2-7-23)31(21-3-8-24(33)9-4-21)39-14-13-38(19-39)17-30(27-12-11-26(35)16-29(27)37)40-18-22-5-10-25(34)15-28(22)36;/h1-16,19,30-31H,17-18H2;1H/q+1;/p-1 |
| InChIKey | YGEIMSMISRCBFF-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)N3C=C[N+](=C3)CC(C4=C(C=C(C=C4)Cl)Cl)OCC5=C(C=C(C=C5)Cl)Cl)Cl.[Cl-] |
