For research use only. Not for therapeutic Use.
Calpain inhibitor II is a cell permeable, peptide aldehyde inhibitor of calpain I (K<sub>i</sub> = 120 nM), calpain II (K<sub>i</sub> = 230 nM), cathepsin B (K<sub>i</sub> = 100 nM), and cathepsin L (K<sub>i</sub> = 0.6 nM). It has been used to demonstrate the involvement of ubiquitin-<wbr></wbr>proteasome protein degradation in various biological systems.
CAS Number | 110115-07-6 |
Synonyms | Ac-Leu-Leu-Met-H;ALLM |
Molecular Formula | C19H35N3O4S |
Purity | ≥95% |
Target | Proteasome |
Storage | -20°C |
IUPAC Name | (2S)-2-acetamido-4-methyl-N-[(2S)-4-methyl-1-[[(2S)-4-methylsulfanyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]pentanamide |
InChI | InChI=1S/C19H35N3O4S/c1-12(2)9-16(20-14(5)24)19(26)22-17(10-13(3)4)18(25)21-15(11-23)7-8-27-6/h11-13,15-17H,7-10H2,1-6H3,(H,20,24)(H,21,25)(H,22,26)/t15-,16-,17-/m0/s1 |
InChIKey | RJWLAIMXRBDUMH-ULQDDVLXSA-N |
SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCSC)C=O)NC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |