For research use only. Not for therapeutic Use.
Calycosin (CAT: I002585) is a natural isoflavonoid compound found in traditional Chinese medicinal herbs such as Radix astragali (Astragalus membranaceous). It possesses various pharmacological activities and has been studied for its potential therapeutic applications. Calycosin exhibits antioxidant, anti-inflammatory, anti-cancer, and neuroprotective properties. It has been shown to inhibit the production of pro-inflammatory cytokines, reduce oxidative stress, and inhibit tumor cell proliferation. Calycosin also demonstrates estrogenic effects and has been investigated for its potential in hormone-related disorders. Additionally, it shows neuroprotective effects by enhancing neuronal survival and protecting against oxidative damage. Calycosin holds promise as a natural compound with diverse biological activities and potential therapeutic benefits.
CAS Number | 20575-57-9 |
Molecular Formula | C16H12O5 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 1 mg/mL in methanol |
Storage | store at -20℃ |
IUPAC Name | 7-hydroxy-3-(3-hydroxy-4-methoxyphenyl)chromen-4-one |
InChI | 1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3 |
InChIKey | ZZAJQOPSWWVMBI-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |