For research use only. Not for therapeutic Use.
Calyxamine B is a natural alkaloid compound isolated from marine sponges, particularly in the genus Calyx. It belongs to a class of bioactive secondary metabolites known for their antimicrobial and cytotoxic properties. Calyxamine B has shown potential in pharmaceutical research for its ability to inhibit the growth of cancer cells and combat microbial infections. Its complex structure and bioactivity make it a valuable subject for studying novel therapeutic agents, contributing to the discovery of new treatments in oncology and infectious diseases.
CAS Number | 150710-72-8 |
Molecular Formula | C12H21NO |
Purity | ≥95% |
Target | Marine natural products |
Storage | -80°C |
IUPAC Name | 1-(2,2,6,6-tetramethylpiperidin-4-ylidene)propan-2-one |
InChI | InChI=1S/C12H21NO/c1-9(14)6-10-7-11(2,3)13-12(4,5)8-10/h6,13H,7-8H2,1-5H3 |
InChIKey | IIIRMHBNGRZGTN-UHFFFAOYSA-N |
SMILES | CC(=O)C=C1CC(NC(C1)(C)C)(C)C |