For research use only. Not for therapeutic Use.
CAM833(Cat No.:I042750)is an investigational small molecule compound being studied for its potential in treating cancer. It functions as a selective inhibitor of specific enzymes or signaling pathways involved in tumor growth, survival, and metastasis. CAM833 is designed to target key molecular drivers of cancer, aiming to disrupt cancer cell proliferation, reduce tumor progression, and overcome resistance to conventional therapies. Early preclinical studies have shown promising results, and ongoing clinical trials are assessing its safety, efficacy, and potential as a targeted cancer therapy. Further research is focused on exploring its therapeutic applications and effectiveness in combination treatments.
CAS Number | 2758364-02-0 |
Synonyms | N-[2-[(2S,4R)-2-[[(1S)-1-(2-chloro-4-methoxyphenyl)ethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]-6-fluoroquinoline-2-carboxamide |
Molecular Formula | C26H26ClFN4O5 |
Purity | ≥95% |
IUPAC Name | N-[2-[(2S,4R)-2-[[(1S)-1-(2-chloro-4-methoxyphenyl)ethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]-6-fluoroquinoline-2-carboxamide |
InChI | InChI=1S/C26H26ClFN4O5/c1-14(19-6-5-18(37-2)11-20(19)27)30-26(36)23-10-17(33)13-32(23)24(34)12-29-25(35)22-7-3-15-9-16(28)4-8-21(15)31-22/h3-9,11,14,17,23,33H,10,12-13H2,1-2H3,(H,29,35)(H,30,36)/t14-,17+,23-/m0/s1 |
InChIKey | PMUWBFKMLGLUTF-KNUWZQJKSA-N |
SMILES | C[C@@H](C1=C(C=C(C=C1)OC)Cl)NC(=O)[C@@H]2C[C@H](CN2C(=O)CNC(=O)C3=NC4=C(C=C3)C=C(C=C4)F)O |